4-Morpholinecarboxamide, N-(4-bromo-3-chlorophenyl)-
CAS No: 89013-83-2
Morpholine
89013-83-2
morpholinecarboxamide,bromo,chlorophenyl,morpholin,morpholine,89013-83-2
2025-10-17 Discover 4-Morpholinecarboxamide, N-(4-bromo-3-chlorophenyl)- (CAS No: 89013-83-2) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.